C12H18N6O2 — CID 706307
1,3,7-trimethyl-8-piperazin-1-ylpurine-2,6-dione (PubChem CID 706307) has the molecular formula C12H18N6O2 and a molecular weight of 278.32 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-piperazin-1-ylpurine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-piperazin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 706307 |
| Molecular Formula | C12H18N6O2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1,3,7-trimethyl-8-piperazin-1-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N3CCNCC3)n2C)n(C)c1=O |
| InChI | InChI=1S/C12H18N6O2/c1-15-8-9(16(2)12(20)17(3)10(8)19)14-11(15)18-6-4-13-5-7-18/h13H,4-7H2,1-3H3 |
| InChIKey | CWQBJMULHKYRNB-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |