C17H23F3N6O4 — CID 22029906
1,3-dimethyl-7-(2-methylprop-2-enyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 22029906) has the molecular formula C17H23F3N6O4 and a molecular weight of 432.40 g/mol. Its IUPAC name is 1,3-dimethyl-7-(2-methylprop-2-enyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 1,3-dimethyl-7-(2-methylprop-2-enyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22029906 |
| Molecular Formula | C17H23F3N6O4 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 1,3-dimethyl-7-(2-methylprop-2-enyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | C=C(C)Cn1c(N2CCNCC2)nc2c1c(=O)n(C)c(=O)n2C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N6O2.C2HF3O2/c1-10(2)9-21-11-12(18(3)15(23)19(4)13(11)22)17-14(21)20-7-5-16-6-8-20;3-2(4,5)1(6)7/h16H,1,5-9H2,2-4H3;(H,6,7) |
| InChIKey | BRIIAPQYHRCHCG-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|