C19H27F3N6O5 — CID 22029936
1-(2-hydroxyethyl)-3-methyl-7-(3-methylbut-2-enyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 22029936) has the molecular formula C19H27F3N6O5 and a molecular weight of 476.46 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-methyl-7-(3-methylbut-2-enyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(2-hydroxyethyl)-3-methyl-7-(3-methylbut-2-enyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22029936 |
| Molecular Formula | C19H27F3N6O5 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-methyl-7-(3-methylbut-2-enyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)=CCn1c(N2CCNCC2)nc2c1c(=O)n(CCO)c(=O)n2C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N6O3.C2HF3O2/c1-12(2)4-7-22-13-14(19-16(22)21-8-5-18-6-9-21)20(3)17(26)23(10-11-24)15(13)25;3-2(4,5)1(6)7/h4,18,24H,5-11H2,1-3H3;(H,6,7) |
| InChIKey | LBKSYUINKNHPJI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 134.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|