C24H30N6O3 — CID 23536873
3-methyl-7-(3-methylbut-2-enyl)-1-[2-(4-methylphenyl)-2-oxoethyl]-8-piperazin-1-ylpurine-2,6-dione (PubChem CID 23536873) has the molecular formula C24H30N6O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is 3-methyl-7-(3-methylbut-2-enyl)-1-[2-(4-methylphenyl)-2-oxoethyl]-8-piperazin-1-ylpurine-2,6-dione.
| Compound Name | 3-methyl-7-(3-methylbut-2-enyl)-1-[2-(4-methylphenyl)-2-oxoethyl]-8-piperazin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 23536873 |
| Molecular Formula | C24H30N6O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 3-methyl-7-(3-methylbut-2-enyl)-1-[2-(4-methylphenyl)-2-oxoethyl]-8-piperazin-1-ylpurine-2,6-dione |
| SMILES | CC(C)=CCn1c(N2CCNCC2)nc2c1c(=O)n(CC(=O)c1ccc(C)cc1)c(=O)n2C |
| InChI | InChI=1S/C24H30N6O3/c1-16(2)9-12-29-20-21(26-23(29)28-13-10-25-11-14-28)27(4)24(33)30(22(20)32)15-19(31)18-7-5-17(3)6-8-18/h5-9,25H,10-15H2,1-4H3 |
| InChIKey | GXZLIRWVFXFHIV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 94.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|