C25H32N6O4 — CID 57499054
8-(3-aminopiperidin-1-yl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione (PubChem CID 57499054) has the molecular formula C25H32N6O4 and a molecular weight of 480.57 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione |
|---|---|
| PubChem CID | 57499054 |
| Molecular Formula | C25H32N6O4 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione |
| SMILES | COc1ccc(C(=O)Cn2c(=O)c3c(nc(N4CCCC(N)C4)n3CC=C(C)C)n(C)c2=O)cc1 |
| InChI | InChI=1S/C25H32N6O4/c1-16(2)11-13-30-21-22(27-24(30)29-12-5-6-18(26)14-29)28(3)25(34)31(23(21)33)15-20(32)17-7-9-19(35-4)10-8-17/h7-11,18H,5-6,12-15,26H2,1-4H3 |
| InChIKey | IAQGTLKIIBBKOB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|