C25H32N6O3 — CID 57499407
8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[2-(2-methylphenyl)-2-oxoethyl]purine-2,6-dione (PubChem CID 57499407) has the molecular formula C25H32N6O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[2-(2-methylphenyl)-2-oxoethyl]purine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[2-(2-methylphenyl)-2-oxoethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 57499407 |
| Molecular Formula | C25H32N6O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[2-(2-methylphenyl)-2-oxoethyl]purine-2,6-dione |
| SMILES | CC(C)=CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(CC(=O)c1ccccc1C)c(=O)n2C |
| InChI | InChI=1S/C25H32N6O3/c1-16(2)11-13-30-21-22(27-24(30)29-12-7-9-18(26)14-29)28(4)25(34)31(23(21)33)15-20(32)19-10-6-5-8-17(19)3/h5-6,8,10-11,18H,7,9,12-15,26H2,1-4H3 |
| InChIKey | XGASKRFZMIZJSN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 108.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|