C26H33N7O4 — CID 57499111
N-[3-[2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]acetyl]phenyl]acetamide (PubChem CID 57499111) has the molecular formula C26H33N7O4 and a molecular weight of 507.60 g/mol. Its IUPAC name is N-[3-[2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]acetyl]phenyl]acetamide.
| Compound Name | N-[3-[2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]acetyl]phenyl]acetamide |
|---|---|
| PubChem CID | 57499111 |
| Molecular Formula | C26H33N7O4 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | N-[3-[2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]acetyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C(=O)Cn2c(=O)c3c(nc(N4CCCC(N)C4)n3CC=C(C)C)n(C)c2=O)c1 |
| InChI | InChI=1S/C26H33N7O4/c1-16(2)10-12-32-22-23(29-25(32)31-11-6-8-19(27)14-31)30(4)26(37)33(24(22)36)15-21(35)18-7-5-9-20(13-18)28-17(3)34/h5,7,9-10,13,19H,6,8,11-12,14-15,27H2,1-4H3,(H,28,34) |
| InChIKey | GYSHOZGNTQFJIB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 137.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|