C26H33N7O4 — CID 175241412
2-[3-[2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]acetyl]anilino]acetaldehyde (PubChem CID 175241412) has the molecular formula C26H33N7O4 and a molecular weight of 507.60 g/mol. Its IUPAC name is 2-[3-[2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]acetyl]anilino]acetaldehyde.
| Compound Name | 2-[3-[2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]acetyl]anilino]acetaldehyde |
|---|---|
| PubChem CID | 175241412 |
| Molecular Formula | C26H33N7O4 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 2-[3-[2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]acetyl]anilino]acetaldehyde |
| SMILES | CC(C)=CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(CC(=O)c1cccc(NCC=O)c1)c(=O)n2C |
| InChI | InChI=1S/C26H33N7O4/c1-17(2)9-12-32-22-23(29-25(32)31-11-5-7-19(27)15-31)30(3)26(37)33(24(22)36)16-21(35)18-6-4-8-20(14-18)28-10-13-34/h4,6,8-9,13-14,19,28H,5,7,10-12,15-16,27H2,1-3H3 |
| InChIKey | DLXQGWLXZUBWOV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 137.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|