C25H32N7O5S- — CID 175241426
[3-[2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]acetyl]anilino]methanesulfinate (PubChem CID 175241426) has the molecular formula C25H32N7O5S- and a molecular weight of 542.64 g/mol. Its IUPAC name is [3-[2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]acetyl]anilino]methanesulfinate.
| Compound Name | [3-[2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]acetyl]anilino]methanesulfinate |
|---|---|
| PubChem CID | 175241426 |
| Molecular Formula | C25H32N7O5S- |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | [3-[2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]acetyl]anilino]methanesulfinate |
| SMILES | CC(C)=CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(CC(=O)c1cccc(NCS(=O)[O-])c1)c(=O)n2C |
| InChI | InChI=1S/C25H33N7O5S/c1-16(2)9-11-31-21-22(28-24(31)30-10-5-7-18(26)13-30)29(3)25(35)32(23(21)34)14-20(33)17-6-4-8-19(12-17)27-15-38(36)37/h4,6,8-9,12,18,27H,5,7,10-11,13-15,26H2,1-3H3,(H,36,37)/p-1 |
| InChIKey | HUAUPBODNHKABU-UHFFFAOYSA-M |
| XLogP | 0.92 |
| TPSA | 160.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|