C24H31N6O4S- — CID 174454844
2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]-1-phenylethanesulfinate (PubChem CID 174454844) has the molecular formula C24H31N6O4S- and a molecular weight of 499.62 g/mol. Its IUPAC name is 2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]-1-phenylethanesulfinate.
| Compound Name | 2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]-1-phenylethanesulfinate |
|---|---|
| PubChem CID | 174454844 |
| Molecular Formula | C24H31N6O4S- |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 2-[8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-1-yl]-1-phenylethanesulfinate |
| SMILES | CC(C)=CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(CC(c1ccccc1)S(=O)[O-])c(=O)n2C |
| InChI | InChI=1S/C24H32N6O4S/c1-16(2)11-13-29-20-21(26-23(29)28-12-7-10-18(25)14-28)27(3)24(32)30(22(20)31)15-19(35(33)34)17-8-5-4-6-9-17/h4-6,8-9,11,18-19H,7,10,12-15,25H2,1-3H3,(H,33,34)/p-1 |
| InChIKey | IVHJTEOGQBLUBN-UHFFFAOYSA-M |
| XLogP | 1.41 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|