C24H33N7O2 — CID 57499355
1-[2-(4-aminophenyl)ethyl]-8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione (PubChem CID 57499355) has the molecular formula C24H33N7O2 and a molecular weight of 451.58 g/mol. Its IUPAC name is 1-[2-(4-aminophenyl)ethyl]-8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione.
| Compound Name | 1-[2-(4-aminophenyl)ethyl]-8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione |
|---|---|
| PubChem CID | 57499355 |
| Molecular Formula | C24H33N7O2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | 1-[2-(4-aminophenyl)ethyl]-8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione |
| SMILES | CC(C)=CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(CCc1ccc(N)cc1)c(=O)n2C |
| InChI | InChI=1S/C24H33N7O2/c1-16(2)10-13-30-20-21(27-23(30)29-12-4-5-19(26)15-29)28(3)24(33)31(22(20)32)14-11-17-6-8-18(25)9-7-17/h6-10,19H,4-5,11-15,25-26H2,1-3H3 |
| InChIKey | UBGRXSIBHFBWBJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|