C24H31N7O4 — CID 57499051
8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[2-(2-nitrophenyl)ethyl]purine-2,6-dione (PubChem CID 57499051) has the molecular formula C24H31N7O4 and a molecular weight of 481.56 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[2-(2-nitrophenyl)ethyl]purine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[2-(2-nitrophenyl)ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 57499051 |
| Molecular Formula | C24H31N7O4 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[2-(2-nitrophenyl)ethyl]purine-2,6-dione |
| SMILES | CC(C)=CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(CCc1ccccc1[N+](=O)[O-])c(=O)n2C |
| InChI | InChI=1S/C24H31N7O4/c1-16(2)10-13-29-20-21(26-23(29)28-12-6-8-18(25)15-28)27(3)24(33)30(22(20)32)14-11-17-7-4-5-9-19(17)31(34)35/h4-5,7,9-10,18H,6,8,11-15,25H2,1-3H3 |
| InChIKey | IEOHEFXNPQQUCR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 134.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|