C28H33N7O2 — CID 10436036
8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[(5-phenyl-2-pyridinyl)methyl]purine-2,6-dione (PubChem CID 10436036) has the molecular formula C28H33N7O2 and a molecular weight of 499.62 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[(5-phenyl-2-pyridinyl)methyl]purine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[(5-phenyl-2-pyridinyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 10436036 |
| Molecular Formula | C28H33N7O2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-3-methyl-7-(3-methylbut-2-enyl)-1-[(5-phenyl-2-pyridinyl)methyl]purine-2,6-dione |
| SMILES | CC(C)=CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(Cc1ccc(-c3ccccc3)cn1)c(=O)n2C |
| InChI | InChI=1S/C28H33N7O2/c1-19(2)13-15-34-24-25(31-27(34)33-14-7-10-22(29)17-33)32(3)28(37)35(26(24)36)18-23-12-11-21(16-30-23)20-8-5-4-6-9-20/h4-6,8-9,11-13,16,22H,7,10,14-15,17-18,29H2,1-3H3 |
| InChIKey | STPBPHSYLYADHR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 103.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|