C32H43ClN8O6 — CID 66753810
tert-butyl N-[1-[1-[2-[3-(2-chloroethylcarbamoylamino)phenyl]-2-oxoethyl]-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate (PubChem CID 66753810) has the molecular formula C32H43ClN8O6 and a molecular weight of 671.20 g/mol. Its IUPAC name is tert-butyl N-[1-[1-[2-[3-(2-chloroethylcarbamoylamino)phenyl]-2-oxoethyl]-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-[2-[3-(2-chloroethylcarbamoylamino)phenyl]-2-oxoethyl]-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 66753810 |
| Molecular Formula | C32H43ClN8O6 |
| Molecular Weight | 671.20 g/mol |
| Exact Mass | 670.30 |
| IUPAC Name | tert-butyl N-[1-[1-[2-[3-(2-chloroethylcarbamoylamino)phenyl]-2-oxoethyl]-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
| SMILES | CC(C)=CCn1c(N2CCCC(NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(CC(=O)c1cccc(NC(=O)NCCCl)c1)c(=O)n2C |
| InChI | InChI=1S/C32H43ClN8O6/c1-20(2)12-16-40-25-26(37-29(40)39-15-8-11-23(18-39)36-30(45)47-32(3,4)5)38(6)31(46)41(27(25)43)19-24(42)21-9-7-10-22(17-21)35-28(44)34-14-13-33/h7,9-10,12,17,23H,8,11,13-16,18-19H2,1-6H3,(H,36,45)(H2,34,35,44) |
| InChIKey | OGIWERHYAAGQBX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.20 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|