C35H54N6O5Si — CID 66723781
tert-butyl N-[(3S)-1-[1-[2-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate (PubChem CID 66723781) has the molecular formula C35H54N6O5Si and a molecular weight of 666.94 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[1-[2-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[1-[2-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 66723781 |
| Molecular Formula | C35H54N6O5Si |
| Molecular Weight | 666.94 g/mol |
| Exact Mass | 666.39 |
| IUPAC Name | tert-butyl N-[(3S)-1-[1-[2-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
| SMILES | CC(C)=CCn1c(N2CCC[C@H](NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(CCc1cccc(O[Si](C)(C)C(C)(C)C)c1)c(=O)n2C |
| InChI | InChI=1S/C35H54N6O5Si/c1-24(2)17-20-40-28-29(37-31(40)39-19-13-15-26(23-39)36-32(43)45-34(3,4)5)38(9)33(44)41(30(28)42)21-18-25-14-12-16-27(22-25)46-47(10,11)35(6,7)8/h12,14,16-17,22,26H,13,15,18-21,23H2,1-11H3,(H,36,43)/t26-/m0/s1 |
| InChIKey | TUCSIQRTIYSWEF-SANMLTNESA-N |
| XLogP | 5.98 |
| TPSA | 112.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.94 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|