C28H37N7O5 — CID 68690170
tert-butyl N-[1-[1-[2-(2-aminophenyl)-2-oxoethyl]-7-but-2-enyl-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate (PubChem CID 68690170) has the molecular formula C28H37N7O5 and a molecular weight of 551.65 g/mol. Its IUPAC name is tert-butyl N-[1-[1-[2-(2-aminophenyl)-2-oxoethyl]-7-but-2-enyl-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-[2-(2-aminophenyl)-2-oxoethyl]-7-but-2-enyl-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 68690170 |
| Molecular Formula | C28H37N7O5 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | tert-butyl N-[1-[1-[2-(2-aminophenyl)-2-oxoethyl]-7-but-2-enyl-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
| SMILES | CC=CCn1c(N2CCCC(NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(CC(=O)c1ccccc1N)c(=O)n2C |
| InChI | InChI=1S/C28H37N7O5/c1-6-7-15-34-22-23(31-25(34)33-14-10-11-18(16-33)30-26(38)40-28(2,3)4)32(5)27(39)35(24(22)37)17-21(36)19-12-8-9-13-20(19)29/h6-9,12-13,18H,10-11,14-17,29H2,1-5H3,(H,30,38) |
| InChIKey | LFEUCHARDAQECR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 146.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|