C30H38N6O6S — CID 66754094
tert-butyl N-[1-[7-but-2-ynyl-3-methyl-1-[2-[2-(methylsulfanylmethoxy)phenyl]-2-oxoethyl]-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate (PubChem CID 66754094) has the molecular formula C30H38N6O6S and a molecular weight of 610.74 g/mol. Its IUPAC name is tert-butyl N-[1-[7-but-2-ynyl-3-methyl-1-[2-[2-(methylsulfanylmethoxy)phenyl]-2-oxoethyl]-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[7-but-2-ynyl-3-methyl-1-[2-[2-(methylsulfanylmethoxy)phenyl]-2-oxoethyl]-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 66754094 |
| Molecular Formula | C30H38N6O6S |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | tert-butyl N-[1-[7-but-2-ynyl-3-methyl-1-[2-[2-(methylsulfanylmethoxy)phenyl]-2-oxoethyl]-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
| SMILES | CC#CCn1c(N2CCCC(NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(CC(=O)c1ccccc1OCSC)c(=O)n2C |
| InChI | InChI=1S/C30H38N6O6S/c1-7-8-16-35-24-25(32-27(35)34-15-11-12-20(17-34)31-28(39)42-30(2,3)4)33(5)29(40)36(26(24)38)18-22(37)21-13-9-10-14-23(21)41-19-43-6/h9-10,13-14,20H,11-12,15-19H2,1-6H3,(H,31,39) |
| InChIKey | KHSSSUHAHMFXGO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 129.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|