C27H35BN6O6 — CID 164595614
[2-[[7-but-2-ynyl-3-methyl-8-[3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-2,6-dioxopurin-1-yl]methyl]phenyl]boronic acid (PubChem CID 164595614) has the molecular formula C27H35BN6O6 and a molecular weight of 550.43 g/mol. Its IUPAC name is [2-[[7-but-2-ynyl-3-methyl-8-[3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-2,6-dioxopurin-1-yl]methyl]phenyl]boronic acid.
| Compound Name | [2-[[7-but-2-ynyl-3-methyl-8-[3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-2,6-dioxopurin-1-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 164595614 |
| Molecular Formula | C27H35BN6O6 |
| Molecular Weight | 550.43 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | [2-[[7-but-2-ynyl-3-methyl-8-[3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-2,6-dioxopurin-1-yl]methyl]phenyl]boronic acid |
| SMILES | CC#CCn1c(N2CCCC(NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(Cc1ccccc1B(O)O)c(=O)n2C |
| InChI | InChI=1S/C27H35BN6O6/c1-6-7-15-33-21-22(30-24(33)32-14-10-12-19(17-32)29-25(36)40-27(2,3)4)31(5)26(37)34(23(21)35)16-18-11-8-9-13-20(18)28(38)39/h8-9,11,13,19,38-39H,10,12,14-17H2,1-5H3,(H,29,36) |
| InChIKey | RZQIBTQRIHZWTI-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 143.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.43 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|