C33H36N8O4 — CID 68603105
tert-butyl N-[1-[1-(benzo[c][1,8]naphthyridin-6-ylmethyl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate (PubChem CID 68603105) has the molecular formula C33H36N8O4 and a molecular weight of 608.70 g/mol. Its IUPAC name is tert-butyl N-[1-[1-(benzo[c][1,8]naphthyridin-6-ylmethyl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-(benzo[c][1,8]naphthyridin-6-ylmethyl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 68603105 |
| Molecular Formula | C33H36N8O4 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | tert-butyl N-[1-[1-(benzo[c][1,8]naphthyridin-6-ylmethyl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
| SMILES | CC#CCn1c(N2CCCC(NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(Cc1nc3ncccc3c3ccccc13)c(=O)n2C |
| InChI | InChI=1S/C33H36N8O4/c1-6-7-18-40-26-28(37-30(40)39-17-11-12-21(19-39)35-31(43)45-33(2,3)4)38(5)32(44)41(29(26)42)20-25-23-14-9-8-13-22(23)24-15-10-16-34-27(24)36-25/h8-10,13-16,21H,11-12,17-20H2,1-5H3,(H,35,43) |
| InChIKey | PEGYDSDFSTVKDP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 129.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|