C36H39N7O4 — CID 66753745
tert-butyl N-[(3R)-1-[7-but-2-ynyl-3-methyl-2,6-dioxo-1-[(3-phenylisoquinolin-1-yl)methyl]purin-8-yl]piperidin-3-yl]carbamate (PubChem CID 66753745) has the molecular formula C36H39N7O4 and a molecular weight of 633.75 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[7-but-2-ynyl-3-methyl-2,6-dioxo-1-[(3-phenylisoquinolin-1-yl)methyl]purin-8-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[7-but-2-ynyl-3-methyl-2,6-dioxo-1-[(3-phenylisoquinolin-1-yl)methyl]purin-8-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 66753745 |
| Molecular Formula | C36H39N7O4 |
| Molecular Weight | 633.75 g/mol |
| Exact Mass | 633.31 |
| IUPAC Name | tert-butyl N-[(3R)-1-[7-but-2-ynyl-3-methyl-2,6-dioxo-1-[(3-phenylisoquinolin-1-yl)methyl]purin-8-yl]piperidin-3-yl]carbamate |
| SMILES | CC#CCn1c(N2CCC[C@@H](NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(Cc1nc(-c3ccccc3)cc3ccccc13)c(=O)n2C |
| InChI | InChI=1S/C36H39N7O4/c1-6-7-20-42-30-31(39-33(42)41-19-13-17-26(22-41)37-34(45)47-36(2,3)4)40(5)35(46)43(32(30)44)23-29-27-18-12-11-16-25(27)21-28(38-29)24-14-9-8-10-15-24/h8-12,14-16,18,21,26H,13,17,19-20,22-23H2,1-5H3,(H,37,45)/t26-/m1/s1 |
| InChIKey | MOILAUCKDPSUKH-AREMUKBSSA-N |
| XLogP | 4.68 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.75 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|