C35H38N8O4 — CID 66754373
tert-butyl N-[1-[7-but-2-ynyl-3-methyl-2,6-dioxo-1-[(2-phenylquinazolin-4-yl)methyl]purin-8-yl]piperidin-3-yl]carbamate (PubChem CID 66754373) has the molecular formula C35H38N8O4 and a molecular weight of 634.74 g/mol. Its IUPAC name is tert-butyl N-[1-[7-but-2-ynyl-3-methyl-2,6-dioxo-1-[(2-phenylquinazolin-4-yl)methyl]purin-8-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[7-but-2-ynyl-3-methyl-2,6-dioxo-1-[(2-phenylquinazolin-4-yl)methyl]purin-8-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 66754373 |
| Molecular Formula | C35H38N8O4 |
| Molecular Weight | 634.74 g/mol |
| Exact Mass | 634.30 |
| IUPAC Name | tert-butyl N-[1-[7-but-2-ynyl-3-methyl-2,6-dioxo-1-[(2-phenylquinazolin-4-yl)methyl]purin-8-yl]piperidin-3-yl]carbamate |
| SMILES | CC#CCn1c(N2CCCC(NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(Cc1nc(-c3ccccc3)nc3ccccc13)c(=O)n2C |
| InChI | InChI=1S/C35H38N8O4/c1-6-7-20-42-28-30(39-32(42)41-19-13-16-24(21-41)36-33(45)47-35(2,3)4)40(5)34(46)43(31(28)44)22-27-25-17-11-12-18-26(25)37-29(38-27)23-14-9-8-10-15-23/h8-12,14-15,17-18,24H,13,16,19-22H2,1-5H3,(H,36,45) |
| InChIKey | ZEQKVOYDTOEBIQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 129.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.74 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|