C31H34N8O4 — CID 68858035
tert-butyl N-[(3R)-1-[7-but-2-ynyl-1-[(5-cyanoquinolin-2-yl)methyl]-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate (PubChem CID 68858035) has the molecular formula C31H34N8O4 and a molecular weight of 582.67 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[7-but-2-ynyl-1-[(5-cyanoquinolin-2-yl)methyl]-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[7-but-2-ynyl-1-[(5-cyanoquinolin-2-yl)methyl]-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 68858035 |
| Molecular Formula | C31H34N8O4 |
| Molecular Weight | 582.67 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | tert-butyl N-[(3R)-1-[7-but-2-ynyl-1-[(5-cyanoquinolin-2-yl)methyl]-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
| SMILES | CC#CCn1c(N2CCC[C@@H](NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(Cc1ccc3c(C#N)cccc3n1)c(=O)n2C |
| InChI | InChI=1S/C31H34N8O4/c1-6-7-16-38-25-26(35-28(38)37-15-9-11-21(18-37)34-29(41)43-31(2,3)4)36(5)30(42)39(27(25)40)19-22-13-14-23-20(17-32)10-8-12-24(23)33-22/h8,10,12-14,21H,9,11,15-16,18-19H2,1-5H3,(H,34,41)/t21-/m1/s1 |
| InChIKey | USMCRXNXBJWPAK-OAQYLSRUSA-N |
| XLogP | 2.88 |
| TPSA | 140.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.67 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|