C31H36N8O4 — CID 123656169
tert-butyl N-[1-[7-but-2-ynyl-1-(5,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-6-ylmethyl)-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate (PubChem CID 123656169) has the molecular formula C31H36N8O4 and a molecular weight of 584.68 g/mol. Its IUPAC name is tert-butyl N-[1-[7-but-2-ynyl-1-(5,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-6-ylmethyl)-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[7-but-2-ynyl-1-(5,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-6-ylmethyl)-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 123656169 |
| Molecular Formula | C31H36N8O4 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | tert-butyl N-[1-[7-but-2-ynyl-1-(5,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-6-ylmethyl)-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
| SMILES | CC#CCn1c(N2CCCC(NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(Cc1nc3c4c(cccc4n1)CC3)c(=O)n2C |
| InChI | InChI=1S/C31H36N8O4/c1-6-7-16-38-25-26(35-28(38)37-15-9-11-20(17-37)32-29(41)43-31(2,3)4)36(5)30(42)39(27(25)40)18-23-33-21-12-8-10-19-13-14-22(34-23)24(19)21/h8,10,12,20H,9,11,13-18H2,1-5H3,(H,32,41) |
| InChIKey | OIWAGJWCHYHQKD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 129.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|