C30H36N8O5 — CID 21088912
tert-butyl N-[(3R)-1-[7-but-2-ynyl-3-methyl-1-[(4-methyl-3-oxidoquinazolin-3-ium-2-yl)methyl]-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate (PubChem CID 21088912) has the molecular formula C30H36N8O5 and a molecular weight of 588.67 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[7-but-2-ynyl-3-methyl-1-[(4-methyl-3-oxidoquinazolin-3-ium-2-yl)methyl]-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[7-but-2-ynyl-3-methyl-1-[(4-methyl-3-oxidoquinazolin-3-ium-2-yl)methyl]-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 21088912 |
| Molecular Formula | C30H36N8O5 |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | tert-butyl N-[(3R)-1-[7-but-2-ynyl-3-methyl-1-[(4-methyl-3-oxidoquinazolin-3-ium-2-yl)methyl]-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
| SMILES | CC#CCn1c(N2CCC[C@@H](NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(Cc1nc3ccccc3c(C)[n+]1[O-])c(=O)n2C |
| InChI | InChI=1S/C30H36N8O5/c1-7-8-16-36-24-25(33-27(36)35-15-11-12-20(17-35)31-28(40)43-30(3,4)5)34(6)29(41)37(26(24)39)18-23-32-22-14-10-9-13-21(22)19(2)38(23)42/h9-10,13-14,20H,11-12,15-18H2,1-6H3,(H,31,40)/t20-/m1/s1 |
| InChIKey | IAKSHMQEBOOHCU-HXUWFJFHSA-N |
| XLogP | 1.95 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|