C28H34N6O5 — CID 66753947
tert-butyl N-[(3R)-1-(7-but-2-ynyl-3-methyl-2,6-dioxo-1-phenacylpurin-8-yl)piperidin-3-yl]carbamate (PubChem CID 66753947) has the molecular formula C28H34N6O5 and a molecular weight of 534.62 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(7-but-2-ynyl-3-methyl-2,6-dioxo-1-phenacylpurin-8-yl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-(7-but-2-ynyl-3-methyl-2,6-dioxo-1-phenacylpurin-8-yl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 66753947 |
| Molecular Formula | C28H34N6O5 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | tert-butyl N-[(3R)-1-(7-but-2-ynyl-3-methyl-2,6-dioxo-1-phenacylpurin-8-yl)piperidin-3-yl]carbamate |
| SMILES | CC#CCn1c(N2CCC[C@@H](NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(CC(=O)c1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C28H34N6O5/c1-6-7-16-33-22-23(30-25(33)32-15-11-14-20(17-32)29-26(37)39-28(2,3)4)31(5)27(38)34(24(22)36)18-21(35)19-12-9-8-10-13-19/h8-10,12-13,20H,11,14-18H2,1-5H3,(H,29,37)/t20-/m1/s1 |
| InChIKey | NDVNVORHXGSIPU-HXUWFJFHSA-N |
| XLogP | 2.30 |
| TPSA | 120.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|