C28H36N8O5 — CID 66754310
tert-butyl N-[1-[1-[2-(2-aminoanilino)-2-oxoethyl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate (PubChem CID 66754310) has the molecular formula C28H36N8O5 and a molecular weight of 564.65 g/mol. Its IUPAC name is tert-butyl N-[1-[1-[2-(2-aminoanilino)-2-oxoethyl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-[2-(2-aminoanilino)-2-oxoethyl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 66754310 |
| Molecular Formula | C28H36N8O5 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | tert-butyl N-[1-[1-[2-(2-aminoanilino)-2-oxoethyl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
| SMILES | CC#CCn1c(N2CCCC(NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(CC(=O)Nc1ccccc1N)c(=O)n2C |
| InChI | InChI=1S/C28H36N8O5/c1-6-7-15-35-22-23(32-25(35)34-14-10-11-18(16-34)30-26(39)41-28(2,3)4)33(5)27(40)36(24(22)38)17-21(37)31-20-13-9-8-12-19(20)29/h8-9,12-13,18H,10-11,14-17,29H2,1-5H3,(H,30,39)(H,31,37) |
| InChIKey | XICDDKPGSIJZLF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 158.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|