C31H37N7O5 — CID 21088911
tert-butyl N-[(3R)-1-[7-but-2-ynyl-3-methyl-1-[(3-methyl-2-oxidoisoquinolin-2-ium-1-yl)methyl]-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate (PubChem CID 21088911) has the molecular formula C31H37N7O5 and a molecular weight of 587.68 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[7-but-2-ynyl-3-methyl-1-[(3-methyl-2-oxidoisoquinolin-2-ium-1-yl)methyl]-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[7-but-2-ynyl-3-methyl-1-[(3-methyl-2-oxidoisoquinolin-2-ium-1-yl)methyl]-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 21088911 |
| Molecular Formula | C31H37N7O5 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | tert-butyl N-[(3R)-1-[7-but-2-ynyl-3-methyl-1-[(3-methyl-2-oxidoisoquinolin-2-ium-1-yl)methyl]-2,6-dioxopurin-8-yl]piperidin-3-yl]carbamate |
| SMILES | CC#CCn1c(N2CCC[C@@H](NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(Cc1c3ccccc3cc(C)[n+]1[O-])c(=O)n2C |
| InChI | InChI=1S/C31H37N7O5/c1-7-8-16-36-25-26(33-28(36)35-15-11-13-22(18-35)32-29(40)43-31(3,4)5)34(6)30(41)37(27(25)39)19-24-23-14-10-9-12-21(23)17-20(2)38(24)42/h9-10,12,14,17,22H,11,13,15-16,18-19H2,1-6H3,(H,32,40)/t22-/m1/s1 |
| InChIKey | AGJQDXWCANDYTQ-JOCHJYFZSA-N |
| XLogP | 2.56 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|