C23H29N7O3 — CID 66753777
1-[2-(2-aminophenyl)-2-oxoethyl]-8-(3-aminopiperidin-1-yl)-7-[(E)-but-2-enyl]-3-methylpurine-2,6-dione (PubChem CID 66753777) has the molecular formula C23H29N7O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is 1-[2-(2-aminophenyl)-2-oxoethyl]-8-(3-aminopiperidin-1-yl)-7-[(E)-but-2-enyl]-3-methylpurine-2,6-dione.
| Compound Name | 1-[2-(2-aminophenyl)-2-oxoethyl]-8-(3-aminopiperidin-1-yl)-7-[(E)-but-2-enyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 66753777 |
| Molecular Formula | C23H29N7O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 1-[2-(2-aminophenyl)-2-oxoethyl]-8-(3-aminopiperidin-1-yl)-7-[(E)-but-2-enyl]-3-methylpurine-2,6-dione |
| SMILES | C/C=C/Cn1c(N2CCCC(N)C2)nc2c1c(=O)n(CC(=O)c1ccccc1N)c(=O)n2C |
| InChI | InChI=1S/C23H29N7O3/c1-3-4-12-29-19-20(26-22(29)28-11-7-8-15(24)13-28)27(2)23(33)30(21(19)32)14-18(31)16-9-5-6-10-17(16)25/h3-6,9-10,15H,7-8,11-14,24-25H2,1-2H3/b4-3+ |
| InChIKey | BCAYOJIDWLTIIJ-ONEGZZNKSA-N |
| XLogP | 0.87 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|