C26H34N8O4 — CID 91322036
1-[2-[2-[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-enyl-3-methyl-2,6-dioxopurin-1-yl]acetyl]phenyl]-1,3-dimethylurea (PubChem CID 91322036) has the molecular formula C26H34N8O4 and a molecular weight of 522.61 g/mol. Its IUPAC name is 1-[2-[2-[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-enyl-3-methyl-2,6-dioxopurin-1-yl]acetyl]phenyl]-1,3-dimethylurea.
| Compound Name | 1-[2-[2-[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-enyl-3-methyl-2,6-dioxopurin-1-yl]acetyl]phenyl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 91322036 |
| Molecular Formula | C26H34N8O4 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 1-[2-[2-[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-enyl-3-methyl-2,6-dioxopurin-1-yl]acetyl]phenyl]-1,3-dimethylurea |
| SMILES | CC=CCn1c(N2CCC[C@@H](N)C2)nc2c1c(=O)n(CC(=O)c1ccccc1N(C)C(=O)NC)c(=O)n2C |
| InChI | InChI=1S/C26H34N8O4/c1-5-6-14-33-21-22(29-24(33)32-13-9-10-17(27)15-32)31(4)26(38)34(23(21)36)16-20(35)18-11-7-8-12-19(18)30(3)25(37)28-2/h5-8,11-12,17H,9-10,13-16,27H2,1-4H3,(H,28,37)/t17-/m1/s1 |
| InChIKey | LBGBVVSJBHPMKL-QGZVFWFLSA-N |
| XLogP | 1.06 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|