C29H39N7O7S — CID 174871122
N-[(3S)-1-[7-[(E)-but-2-enyl]-1-[2-[2-(methanesulfonamido)phenyl]-2-oxoethyl]-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]-N-[(2-methylpropan-2-yl)oxy]formamide (PubChem CID 174871122) has the molecular formula C29H39N7O7S and a molecular weight of 629.74 g/mol. Its IUPAC name is N-[(3S)-1-[7-[(E)-but-2-enyl]-1-[2-[2-(methanesulfonamido)phenyl]-2-oxoethyl]-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]-N-[(2-methylpropan-2-yl)oxy]formamide.
| Compound Name | N-[(3S)-1-[7-[(E)-but-2-enyl]-1-[2-[2-(methanesulfonamido)phenyl]-2-oxoethyl]-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]-N-[(2-methylpropan-2-yl)oxy]formamide |
|---|---|
| PubChem CID | 174871122 |
| Molecular Formula | C29H39N7O7S |
| Molecular Weight | 629.74 g/mol |
| Exact Mass | 629.26 |
| IUPAC Name | N-[(3S)-1-[7-[(E)-but-2-enyl]-1-[2-[2-(methanesulfonamido)phenyl]-2-oxoethyl]-3-methyl-2,6-dioxopurin-8-yl]piperidin-3-yl]-N-[(2-methylpropan-2-yl)oxy]formamide |
| SMILES | C/C=C/Cn1c(N2CCC[C@H](N(C=O)OC(C)(C)C)C2)nc2c1c(=O)n(CC(=O)c1ccccc1NS(C)(=O)=O)c(=O)n2C |
| InChI | InChI=1S/C29H39N7O7S/c1-7-8-16-34-24-25(30-27(34)33-15-11-12-20(17-33)36(19-37)43-29(2,3)4)32(5)28(40)35(26(24)39)18-23(38)21-13-9-10-14-22(21)31-44(6,41)42/h7-10,13-14,19-20,31H,11-12,15-18H2,1-6H3/b8-7+/t20-/m0/s1 |
| InChIKey | JZTHPNWSTJVNAH-DUIUGDAFSA-N |
| XLogP | 1.88 |
| TPSA | 157.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.74 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|