C25H28BrN7O2 — CID 89289254
1-[(2-aminophenyl)methyl]-8-(3-aminopiperidin-1-yl)-7-[(2-bromophenyl)methyl]-3-methylpurine-2,6-dione (PubChem CID 89289254) has the molecular formula C25H28BrN7O2 and a molecular weight of 538.45 g/mol. Its IUPAC name is 1-[(2-aminophenyl)methyl]-8-(3-aminopiperidin-1-yl)-7-[(2-bromophenyl)methyl]-3-methylpurine-2,6-dione.
| Compound Name | 1-[(2-aminophenyl)methyl]-8-(3-aminopiperidin-1-yl)-7-[(2-bromophenyl)methyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 89289254 |
| Molecular Formula | C25H28BrN7O2 |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 1-[(2-aminophenyl)methyl]-8-(3-aminopiperidin-1-yl)-7-[(2-bromophenyl)methyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)n(Cc2ccccc2N)c(=O)c2c1nc(N1CCCC(N)C1)n2Cc1ccccc1Br |
| InChI | InChI=1S/C25H28BrN7O2/c1-30-22-21(23(34)33(25(30)35)14-17-8-3-5-11-20(17)28)32(13-16-7-2-4-10-19(16)26)24(29-22)31-12-6-9-18(27)15-31/h2-5,7-8,10-11,18H,6,9,12-15,27-28H2,1H3 |
| InChIKey | ROLKRSQHROROKH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|