C29H33N7O2 — CID 70903378
8-(3-aminopiperidin-1-yl)-7-ethyl-3-methyl-1-[(11-methylbenzo[b][1]benzazepin-5-yl)methyl]purine-2,6-dione (PubChem CID 70903378) has the molecular formula C29H33N7O2 and a molecular weight of 511.63 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-ethyl-3-methyl-1-[(11-methylbenzo[b][1]benzazepin-5-yl)methyl]purine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-ethyl-3-methyl-1-[(11-methylbenzo[b][1]benzazepin-5-yl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 70903378 |
| Molecular Formula | C29H33N7O2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-ethyl-3-methyl-1-[(11-methylbenzo[b][1]benzazepin-5-yl)methyl]purine-2,6-dione |
| SMILES | CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(CC1=Cc3ccccc3N(C)c3ccccc31)c(=O)n2C |
| InChI | InChI=1S/C29H33N7O2/c1-4-35-25-26(31-28(35)34-15-9-11-21(30)18-34)33(3)29(38)36(27(25)37)17-20-16-19-10-5-7-13-23(19)32(2)24-14-8-6-12-22(20)24/h5-8,10,12-14,16,21H,4,9,11,15,17-18,30H2,1-3H3 |
| InChIKey | NVNRRGLUJYKOGB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|