C26H30BrN7O2 — CID 67562630
8-[[(1S,2R)-2-aminocyclohexyl]amino]-1-[(2-aminophenyl)methyl]-7-[(2-bromophenyl)methyl]-3-methylpurine-2,6-dione (PubChem CID 67562630) has the molecular formula C26H30BrN7O2 and a molecular weight of 552.48 g/mol. Its IUPAC name is 8-[[(1S,2R)-2-aminocyclohexyl]amino]-1-[(2-aminophenyl)methyl]-7-[(2-bromophenyl)methyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-[[(1S,2R)-2-aminocyclohexyl]amino]-1-[(2-aminophenyl)methyl]-7-[(2-bromophenyl)methyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 67562630 |
| Molecular Formula | C26H30BrN7O2 |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | 8-[[(1S,2R)-2-aminocyclohexyl]amino]-1-[(2-aminophenyl)methyl]-7-[(2-bromophenyl)methyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)n(Cc2ccccc2N)c(=O)c2c1nc(N[C@H]1CCCC[C@H]1N)n2Cc1ccccc1Br |
| InChI | InChI=1S/C26H30BrN7O2/c1-32-23-22(24(35)34(26(32)36)15-17-9-3-5-11-19(17)28)33(14-16-8-2-4-10-18(16)27)25(31-23)30-21-13-7-6-12-20(21)29/h2-5,8-11,20-21H,6-7,12-15,28-29H2,1H3,(H,30,31)/t20-,21+/m1/s1 |
| InChIKey | KALSZBZVRYQALQ-RTWAWAEBSA-N |
| XLogP | 3.02 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|