C26H29N5O2 — CID 23527110
8-(cyclohexylamino)-1,3-dimethyl-7-[(2-phenylphenyl)methyl]purine-2,6-dione (PubChem CID 23527110) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 8-(cyclohexylamino)-1,3-dimethyl-7-[(2-phenylphenyl)methyl]purine-2,6-dione.
| Compound Name | 8-(cyclohexylamino)-1,3-dimethyl-7-[(2-phenylphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 23527110 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 8-(cyclohexylamino)-1,3-dimethyl-7-[(2-phenylphenyl)methyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NC3CCCCC3)n2Cc2ccccc2-c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C26H29N5O2/c1-29-23-22(24(32)30(2)26(29)33)31(25(28-23)27-20-14-7-4-8-15-20)17-19-13-9-10-16-21(19)18-11-5-3-6-12-18/h3,5-6,9-13,16,20H,4,7-8,14-15,17H2,1-2H3,(H,27,28) |
| InChIKey | AQKJBFMSVUOKEW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |