C20H24BrN5O2 — CID 1277648
7-[(2-bromophenyl)methyl]-8-(cyclohexylamino)-1,3-dimethylpurine-2,6-dione (PubChem CID 1277648) has the molecular formula C20H24BrN5O2 and a molecular weight of 446.35 g/mol. Its IUPAC name is 7-[(2-bromophenyl)methyl]-8-(cyclohexylamino)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(2-bromophenyl)methyl]-8-(cyclohexylamino)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 1277648 |
| Molecular Formula | C20H24BrN5O2 |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 7-[(2-bromophenyl)methyl]-8-(cyclohexylamino)-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NC3CCCCC3)n2Cc2ccccc2Br)n(C)c1=O |
| InChI | InChI=1S/C20H24BrN5O2/c1-24-17-16(18(27)25(2)20(24)28)26(12-13-8-6-7-11-15(13)21)19(23-17)22-14-9-4-3-5-10-14/h6-8,11,14H,3-5,9-10,12H2,1-2H3,(H,22,23) |
| InChIKey | XXGSCGMMQTYQKC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |