C20H24N6O4 — CID 23527109
8-(cyclohexylamino)-1,3-dimethyl-7-[(2-nitrophenyl)methyl]purine-2,6-dione (PubChem CID 23527109) has the molecular formula C20H24N6O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is 8-(cyclohexylamino)-1,3-dimethyl-7-[(2-nitrophenyl)methyl]purine-2,6-dione.
| Compound Name | 8-(cyclohexylamino)-1,3-dimethyl-7-[(2-nitrophenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 23527109 |
| Molecular Formula | C20H24N6O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 8-(cyclohexylamino)-1,3-dimethyl-7-[(2-nitrophenyl)methyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NC3CCCCC3)n2Cc2ccccc2[N+](=O)[O-])n(C)c1=O |
| InChI | InChI=1S/C20H24N6O4/c1-23-17-16(18(27)24(2)20(23)28)25(12-13-8-6-7-11-15(13)26(29)30)19(22-17)21-14-9-4-3-5-10-14/h6-8,11,14H,3-5,9-10,12H2,1-2H3,(H,21,22) |
| InChIKey | VZSDLHOTASMLKB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|