C20H23Cl2N5O2 — CID 23527127
8-(cyclohexylamino)-7-[(2,6-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 23527127) has the molecular formula C20H23Cl2N5O2 and a molecular weight of 436.34 g/mol. Its IUPAC name is 8-(cyclohexylamino)-7-[(2,6-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-(cyclohexylamino)-7-[(2,6-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 23527127 |
| Molecular Formula | C20H23Cl2N5O2 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 8-(cyclohexylamino)-7-[(2,6-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NC3CCCCC3)n2Cc2c(Cl)cccc2Cl)n(C)c1=O |
| InChI | InChI=1S/C20H23Cl2N5O2/c1-25-17-16(18(28)26(2)20(25)29)27(11-13-14(21)9-6-10-15(13)22)19(24-17)23-12-7-4-3-5-8-12/h6,9-10,12H,3-5,7-8,11H2,1-2H3,(H,23,24) |
| InChIKey | LLQQXCNQZJAQAM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |