C27H30N6O3 — CID 69302777
8-[[(1R,2S)-2-aminocyclohexyl]amino]-7-benzyl-3-methyl-1-phenacylpurine-2,6-dione (PubChem CID 69302777) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is 8-[[(1R,2S)-2-aminocyclohexyl]amino]-7-benzyl-3-methyl-1-phenacylpurine-2,6-dione.
| Compound Name | 8-[[(1R,2S)-2-aminocyclohexyl]amino]-7-benzyl-3-methyl-1-phenacylpurine-2,6-dione |
|---|---|
| PubChem CID | 69302777 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 8-[[(1R,2S)-2-aminocyclohexyl]amino]-7-benzyl-3-methyl-1-phenacylpurine-2,6-dione |
| SMILES | Cn1c(=O)n(CC(=O)c2ccccc2)c(=O)c2c1nc(N[C@@H]1CCCC[C@@H]1N)n2Cc1ccccc1 |
| InChI | InChI=1S/C27H30N6O3/c1-31-24-23(25(35)33(27(31)36)17-22(34)19-12-6-3-7-13-19)32(16-18-10-4-2-5-11-18)26(30-24)29-21-15-9-8-14-20(21)28/h2-7,10-13,20-21H,8-9,14-17,28H2,1H3,(H,29,30)/t20-,21+/m0/s1 |
| InChIKey | HSTHDIDMBDRWBD-LEWJYISDSA-N |
| XLogP | 2.51 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |