C27H34N6O3 — CID 142881428
8-(3-aminoazepan-1-yl)-7-(cyclohex-2-en-1-ylmethyl)-3-methyl-1-phenacylpurine-2,6-dione (PubChem CID 142881428) has the molecular formula C27H34N6O3 and a molecular weight of 490.61 g/mol. Its IUPAC name is 8-(3-aminoazepan-1-yl)-7-(cyclohex-2-en-1-ylmethyl)-3-methyl-1-phenacylpurine-2,6-dione.
| Compound Name | 8-(3-aminoazepan-1-yl)-7-(cyclohex-2-en-1-ylmethyl)-3-methyl-1-phenacylpurine-2,6-dione |
|---|---|
| PubChem CID | 142881428 |
| Molecular Formula | C27H34N6O3 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 8-(3-aminoazepan-1-yl)-7-(cyclohex-2-en-1-ylmethyl)-3-methyl-1-phenacylpurine-2,6-dione |
| SMILES | Cn1c(=O)n(CC(=O)c2ccccc2)c(=O)c2c1nc(N1CCCCC(N)C1)n2CC1C=CCCC1 |
| InChI | InChI=1S/C27H34N6O3/c1-30-24-23(25(35)33(27(30)36)18-22(34)20-12-6-3-7-13-20)32(16-19-10-4-2-5-11-19)26(29-24)31-15-9-8-14-21(28)17-31/h3-4,6-7,10,12-13,19,21H,2,5,8-9,11,14-18,28H2,1H3 |
| InChIKey | IYUDUABBHQITMA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 108.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|