C26H30N6O4 — CID 68858300
8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-1-[2-(3-cyclopropyloxyphenyl)-2-oxoethyl]-3-methylpurine-2,6-dione (PubChem CID 68858300) has the molecular formula C26H30N6O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is 8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-1-[2-(3-cyclopropyloxyphenyl)-2-oxoethyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-1-[2-(3-cyclopropyloxyphenyl)-2-oxoethyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 68858300 |
| Molecular Formula | C26H30N6O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-1-[2-(3-cyclopropyloxyphenyl)-2-oxoethyl]-3-methylpurine-2,6-dione |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)nc2c1c(=O)n(CC(=O)c1cccc(OC3CC3)c1)c(=O)n2C |
| InChI | InChI=1S/C26H30N6O4/c1-3-4-13-31-22-23(28-25(31)30-12-6-8-18(27)15-30)29(2)26(35)32(24(22)34)16-21(33)17-7-5-9-20(14-17)36-19-10-11-19/h5,7,9,14,18-19H,6,8,10-13,15-16,27H2,1-2H3/t18-/m1/s1 |
| InChIKey | KOEWYXZHBUEUDN-GOSISDBHSA-N |
| XLogP | 1.27 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|