C27H33N7O5 — CID 11756940
2-[2-[2-[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]acetyl]phenoxy]-N-ethylacetamide (PubChem CID 11756940) has the molecular formula C27H33N7O5 and a molecular weight of 535.61 g/mol. Its IUPAC name is 2-[2-[2-[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]acetyl]phenoxy]-N-ethylacetamide.
| Compound Name | 2-[2-[2-[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]acetyl]phenoxy]-N-ethylacetamide |
|---|---|
| PubChem CID | 11756940 |
| Molecular Formula | C27H33N7O5 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 2-[2-[2-[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]acetyl]phenoxy]-N-ethylacetamide |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)nc2c1c(=O)n(CC(=O)c1ccccc1OCC(=O)NCC)c(=O)n2C |
| InChI | InChI=1S/C27H33N7O5/c1-4-6-14-33-23-24(30-26(33)32-13-9-10-18(28)15-32)31(3)27(38)34(25(23)37)16-20(35)19-11-7-8-12-21(19)39-17-22(36)29-5-2/h7-8,11-12,18H,5,9-10,13-17,28H2,1-3H3,(H,29,36)/t18-/m1/s1 |
| InChIKey | QCYGZVPIRYMZSH-GOSISDBHSA-N |
| XLogP | 0.25 |
| TPSA | 146.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|