C22H26N8O3 — CID 10253227
2-[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]-N-pyridin-3-ylacetamide (PubChem CID 10253227) has the molecular formula C22H26N8O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 10253227 |
| Molecular Formula | C22H26N8O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 2-[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]-N-pyridin-3-ylacetamide |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)nc2c1c(=O)n(CC(=O)Nc1cccnc1)c(=O)n2C |
| InChI | InChI=1S/C22H26N8O3/c1-3-4-11-29-18-19(26-21(29)28-10-6-7-15(23)13-28)27(2)22(33)30(20(18)32)14-17(31)25-16-8-5-9-24-12-16/h5,8-9,12,15H,6-7,10-11,13-14,23H2,1-2H3,(H,25,31)/t15-/m1/s1 |
| InChIKey | XRFZJHMDBXXHGI-OAHLLOKOSA-N |
| XLogP | -0.12 |
| TPSA | 133.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|