C27H32N8O4 — CID 46829580
acetic acid;8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]purine-2,6-dione (PubChem CID 46829580) has the molecular formula C27H32N8O4 and a molecular weight of 532.61 g/mol. Its IUPAC name is acetic acid;8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]purine-2,6-dione.
| Compound Name | acetic acid;8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 46829580 |
| Molecular Formula | C27H32N8O4 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | acetic acid;8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]purine-2,6-dione |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)nc2c1c(=O)n(Cc1nc(C)c3ccccc3n1)c(=O)n2C.CC(=O)O |
| InChI | InChI=1S/C25H28N8O2.C2H4O2/c1-4-5-13-32-21-22(29-24(32)31-12-8-9-17(26)14-31)30(3)25(35)33(23(21)34)15-20-27-16(2)18-10-6-7-11-19(18)28-20;1-2(3)4/h6-7,10-11,17H,8-9,12-15,26H2,1-3H3;1H3,(H,3,4)/t17-;/m1./s1 |
| InChIKey | VWSFSSXXXNSKTP-UNTBIKODSA-N |
| XLogP | 1.24 |
| TPSA | 154.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|