C35H36N8O4 — CID 134312199
7-but-2-ynyl-8-[3-[2,5-dioxo-3,4-bis[(Z)-prop-1-enyl]pyrrol-1-yl]piperidin-1-yl]-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]purine-2,6-dione (PubChem CID 134312199) has the molecular formula C35H36N8O4 and a molecular weight of 632.73 g/mol. Its IUPAC name is 7-but-2-ynyl-8-[3-[2,5-dioxo-3,4-bis[(Z)-prop-1-enyl]pyrrol-1-yl]piperidin-1-yl]-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]purine-2,6-dione.
| Compound Name | 7-but-2-ynyl-8-[3-[2,5-dioxo-3,4-bis[(Z)-prop-1-enyl]pyrrol-1-yl]piperidin-1-yl]-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 134312199 |
| Molecular Formula | C35H36N8O4 |
| Molecular Weight | 632.73 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | 7-but-2-ynyl-8-[3-[2,5-dioxo-3,4-bis[(Z)-prop-1-enyl]pyrrol-1-yl]piperidin-1-yl]-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]purine-2,6-dione |
| SMILES | CC#CCn1c(N2CCCC(N3C(=O)C(/C=C\C)=C(/C=C\C)C3=O)C2)nc2c1c(=O)n(Cc1nc(C)c3ccccc3n1)c(=O)n2C |
| InChI | InChI=1S/C35H36N8O4/c1-6-9-19-41-29-30(39(5)35(47)42(33(29)46)21-28-36-22(4)24-16-10-11-17-27(24)37-28)38-34(41)40-18-12-15-23(20-40)43-31(44)25(13-7-2)26(14-8-3)32(43)45/h7-8,10-11,13-14,16-17,23H,12,15,18-21H2,1-5H3/b13-7-,14-8- |
| InChIKey | LXWYGANWOAYMMQ-PVRNWPCDSA-N |
| XLogP | 3.01 |
| TPSA | 128.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.73 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|