C32H31N9O4 — CID 153363340
7-but-2-ynyl-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]-8-[(3R)-3-[(4-nitrophenyl)methylideneamino]piperidin-1-yl]purine-2,6-dione (PubChem CID 153363340) has the molecular formula C32H31N9O4 and a molecular weight of 605.66 g/mol. Its IUPAC name is 7-but-2-ynyl-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]-8-[(3R)-3-[(4-nitrophenyl)methylideneamino]piperidin-1-yl]purine-2,6-dione.
| Compound Name | 7-but-2-ynyl-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]-8-[(3R)-3-[(4-nitrophenyl)methylideneamino]piperidin-1-yl]purine-2,6-dione |
|---|---|
| PubChem CID | 153363340 |
| Molecular Formula | C32H31N9O4 |
| Molecular Weight | 605.66 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | 7-but-2-ynyl-3-methyl-1-[(4-methylquinazolin-2-yl)methyl]-8-[(3R)-3-[(4-nitrophenyl)methylideneamino]piperidin-1-yl]purine-2,6-dione |
| SMILES | CC#CCn1c(N2CCC[C@@H](/N=C/c3ccc([N+](=O)[O-])cc3)C2)nc2c1c(=O)n(Cc1nc(C)c3ccccc3n1)c(=O)n2C |
| InChI | InChI=1S/C32H31N9O4/c1-4-5-17-39-28-29(36-31(39)38-16-8-9-23(19-38)33-18-22-12-14-24(15-13-22)41(44)45)37(3)32(43)40(30(28)42)20-27-34-21(2)25-10-6-7-11-26(25)35-27/h6-7,10-15,18,23H,8-9,16-17,19-20H2,1-3H3/b33-18+/t23-/m1/s1 |
| InChIKey | KSWKXUQHXVRDII-ILMWTIGCSA-N |
| XLogP | 3.22 |
| TPSA | 146.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.66 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|