C34H32N8O4 — CID 123314136
7-but-2-ynyl-3-methyl-8-[3-(5-methyl-1,3-dioxoisoindol-2-yl)piperidin-1-yl]-1-[(4-methylquinazolin-2-yl)methyl]purine-2,6-dione (PubChem CID 123314136) has the molecular formula C34H32N8O4 and a molecular weight of 616.68 g/mol. Its IUPAC name is 7-but-2-ynyl-3-methyl-8-[3-(5-methyl-1,3-dioxoisoindol-2-yl)piperidin-1-yl]-1-[(4-methylquinazolin-2-yl)methyl]purine-2,6-dione.
| Compound Name | 7-but-2-ynyl-3-methyl-8-[3-(5-methyl-1,3-dioxoisoindol-2-yl)piperidin-1-yl]-1-[(4-methylquinazolin-2-yl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 123314136 |
| Molecular Formula | C34H32N8O4 |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | 7-but-2-ynyl-3-methyl-8-[3-(5-methyl-1,3-dioxoisoindol-2-yl)piperidin-1-yl]-1-[(4-methylquinazolin-2-yl)methyl]purine-2,6-dione |
| SMILES | CC#CCn1c(N2CCCC(N3C(=O)c4ccc(C)cc4C3=O)C2)nc2c1c(=O)n(Cc1nc(C)c3ccccc3n1)c(=O)n2C |
| InChI | InChI=1S/C34H32N8O4/c1-5-6-16-40-28-29(38(4)34(46)41(32(28)45)19-27-35-21(3)23-11-7-8-12-26(23)36-27)37-33(40)39-15-9-10-22(18-39)42-30(43)24-14-13-20(2)17-25(24)31(42)44/h7-8,11-14,17,22H,9-10,15-16,18-19H2,1-4H3 |
| InChIKey | AGWYFWXRPWKTBR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 128.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|