C23H28N8O3 — CID 68830365
2-[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 68830365) has the molecular formula C23H28N8O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is 2-[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 68830365 |
| Molecular Formula | C23H28N8O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 2-[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(CC(=O)NCc1ccccn1)c(=O)n2C |
| InChI | InChI=1S/C23H28N8O3/c1-3-4-12-30-19-20(27-22(30)29-11-7-8-16(24)14-29)28(2)23(34)31(21(19)33)15-18(32)26-13-17-9-5-6-10-25-17/h5-6,9-10,16H,7-8,11-15,24H2,1-2H3,(H,26,32) |
| InChIKey | OPNQOCLNFLTDCO-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 133.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|