C23H26N8O2 — CID 66753881
8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-methylpurine-2,6-dione (PubChem CID 66753881) has the molecular formula C23H26N8O2 and a molecular weight of 446.52 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-methylpurine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 66753881 |
| Molecular Formula | C23H26N8O2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-1-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-methylpurine-2,6-dione |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(Cc1cn3ccccc3n1)c(=O)n2C |
| InChI | InChI=1S/C23H26N8O2/c1-3-4-12-30-19-20(26-22(30)29-11-7-8-16(24)13-29)27(2)23(33)31(21(19)32)15-17-14-28-10-6-5-9-18(28)25-17/h5-6,9-10,14,16H,7-8,11-13,15,24H2,1-2H3 |
| InChIKey | IPTNMXJUCFBFIL-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|