C21H23N9O2 — CID 149389017
3-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]pyrazine-2-carbonitrile (PubChem CID 149389017) has the molecular formula C21H23N9O2 and a molecular weight of 433.48 g/mol. Its IUPAC name is 3-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]pyrazine-2-carbonitrile.
| Compound Name | 3-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 149389017 |
| Molecular Formula | C21H23N9O2 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 3-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]pyrazine-2-carbonitrile |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(Cc1nccnc1C#N)c(=O)n2C |
| InChI | InChI=1S/C21H23N9O2/c1-3-4-10-29-17-18(26-20(29)28-9-5-6-14(23)12-28)27(2)21(32)30(19(17)31)13-16-15(11-22)24-7-8-25-16/h7-8,14H,5-6,9-10,12-13,23H2,1-2H3 |
| InChIKey | YNDVTDKMXMMQIW-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|