C23H23F2N7O2 — CID 134409932
2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-4,5-difluorobenzonitrile (PubChem CID 134409932) has the molecular formula C23H23F2N7O2 and a molecular weight of 467.48 g/mol. Its IUPAC name is 2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-4,5-difluorobenzonitrile.
| Compound Name | 2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-4,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 134409932 |
| Molecular Formula | C23H23F2N7O2 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-4,5-difluorobenzonitrile |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)nc2c1c(=O)n(Cc1cc(F)c(F)cc1C#N)c(=O)n2C |
| InChI | InChI=1S/C23H23F2N7O2/c1-3-4-8-31-19-20(28-22(31)30-7-5-6-16(27)13-30)29(2)23(34)32(21(19)33)12-15-10-18(25)17(24)9-14(15)11-26/h9-10,16H,5-8,12-13,27H2,1-2H3/t16-/m1/s1 |
| InChIKey | GNCDDCIGQBHFKJ-MRXNPFEDSA-N |
| XLogP | 1.05 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|